C21H32BNO4 — CID 162677583
2-methyl-1-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]piperidin-1-yl]propan-1-one (PubChem CID 162677583) has the molecular formula C21H32BNO4 and a molecular weight of 373.30 g/mol. Its IUPAC name is 2-methyl-1-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]piperidin-1-yl]propan-1-one.
| Compound Name | 2-methyl-1-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 162677583 |
| Molecular Formula | C21H32BNO4 |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 2-methyl-1-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]piperidin-1-yl]propan-1-one |
| SMILES | CC(C)C(=O)N1CCC(Oc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)CC1 |
| InChI | InChI=1S/C21H32BNO4/c1-15(2)19(24)23-13-11-18(12-14-23)25-17-9-7-16(8-10-17)22-26-20(3,4)21(5,6)27-22/h7-10,15,18H,11-14H2,1-6H3 |
| InChIKey | ZVSWNTFYLXFZHT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|