C20H30BNO4 — CID 168984962
4-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]cyclobutyl]morpholine (PubChem CID 168984962) has the molecular formula C20H30BNO4 and a molecular weight of 359.28 g/mol. Its IUPAC name is 4-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]cyclobutyl]morpholine.
| Compound Name | 4-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]cyclobutyl]morpholine |
|---|---|
| PubChem CID | 168984962 |
| Molecular Formula | C20H30BNO4 |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 4-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]cyclobutyl]morpholine |
| SMILES | CC1(C)OB(c2ccc(OC3CC(N4CCOCC4)C3)cc2)OC1(C)C |
| InChI | InChI=1S/C20H30BNO4/c1-19(2)20(3,4)26-21(25-19)15-5-7-17(8-6-15)24-18-13-16(14-18)22-9-11-23-12-10-22/h5-8,16,18H,9-14H2,1-4H3 |
| InChIKey | WWUKSLDEAFMWDZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|