C23H37BN2O3 — CID 175297799
1-[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(oxan-4-yl)piperazine (PubChem CID 175297799) has the molecular formula C23H37BN2O3 and a molecular weight of 400.37 g/mol. Its IUPAC name is 1-[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(oxan-4-yl)piperazine.
| Compound Name | 1-[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(oxan-4-yl)piperazine |
|---|---|
| PubChem CID | 175297799 |
| Molecular Formula | C23H37BN2O3 |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.29 |
| IUPAC Name | 1-[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(oxan-4-yl)piperazine |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(C)c1N1CCN(C2CCOCC2)CC1 |
| InChI | InChI=1S/C23H37BN2O3/c1-17-15-19(24-28-22(3,4)23(5,6)29-24)16-18(2)21(17)26-11-9-25(10-12-26)20-7-13-27-14-8-20/h15-16,20H,7-14H2,1-6H3 |
| InChIKey | IEMIVKCNHFIKNM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|