C14H23N5O3 — CID 50956205
2,4-dimethoxy-6-[4-(oxan-4-yl)piperazin-1-yl]-1,3,5-triazine (PubChem CID 50956205) has the molecular formula C14H23N5O3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2,4-dimethoxy-6-[4-(oxan-4-yl)piperazin-1-yl]-1,3,5-triazine.
| Compound Name | 2,4-dimethoxy-6-[4-(oxan-4-yl)piperazin-1-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 50956205 |
| Molecular Formula | C14H23N5O3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 2,4-dimethoxy-6-[4-(oxan-4-yl)piperazin-1-yl]-1,3,5-triazine |
| SMILES | COc1nc(OC)nc(N2CCN(C3CCOCC3)CC2)n1 |
| InChI | InChI=1S/C14H23N5O3/c1-20-13-15-12(16-14(17-13)21-2)19-7-5-18(6-8-19)11-3-9-22-10-4-11/h11H,3-10H2,1-2H3 |
| InChIKey | VKJWUKXJZOTBAG-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 72.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |