C11H18N4O2 — CID 141014855
2,4-dimethoxy-6-(4-methylpiperidin-1-yl)-1,3,5-triazine (PubChem CID 141014855) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2,4-dimethoxy-6-(4-methylpiperidin-1-yl)-1,3,5-triazine.
| Compound Name | 2,4-dimethoxy-6-(4-methylpiperidin-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 141014855 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 2,4-dimethoxy-6-(4-methylpiperidin-1-yl)-1,3,5-triazine |
| SMILES | COc1nc(OC)nc(N2CCC(C)CC2)n1 |
| InChI | InChI=1S/C11H18N4O2/c1-8-4-6-15(7-5-8)9-12-10(16-2)14-11(13-9)17-3/h8H,4-7H2,1-3H3 |
| InChIKey | NLPLNGVAPHXGLM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |