C12H19ClN4O2 — CID 106838427
2-[4-(1-chloroethyl)piperidin-1-yl]-4,6-dimethoxy-1,3,5-triazine (PubChem CID 106838427) has the molecular formula C12H19ClN4O2 and a molecular weight of 286.76 g/mol. Its IUPAC name is 2-[4-(1-chloroethyl)piperidin-1-yl]-4,6-dimethoxy-1,3,5-triazine.
| Compound Name | 2-[4-(1-chloroethyl)piperidin-1-yl]-4,6-dimethoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 106838427 |
| Molecular Formula | C12H19ClN4O2 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-[4-(1-chloroethyl)piperidin-1-yl]-4,6-dimethoxy-1,3,5-triazine |
| SMILES | COc1nc(OC)nc(N2CCC(C(C)Cl)CC2)n1 |
| InChI | InChI=1S/C12H19ClN4O2/c1-8(13)9-4-6-17(7-5-9)10-14-11(18-2)16-12(15-10)19-3/h8-9H,4-7H2,1-3H3 |
| InChIKey | OBRVTTQMWLNGBA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|