C11H20ClN5O2 — CID 11335249
(4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)-trimethylazanium chloride (PubChem CID 11335249) has the molecular formula C11H20ClN5O2 and a molecular weight of 289.77 g/mol. Its IUPAC name is (4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)-trimethylazanium chloride.
| Compound Name | (4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)-trimethylazanium chloride |
|---|---|
| PubChem CID | 11335249 |
| Molecular Formula | C11H20ClN5O2 |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-yl)-trimethylazanium chloride |
| SMILES | COc1nc(N2CCOCC2)nc([N+](C)(C)C)n1.[Cl-] |
| InChI | InChI=1S/C11H20N5O2.ClH/c1-16(2,3)10-12-9(13-11(14-10)17-4)15-5-7-18-8-6-15;/h5-8H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ASHVKCISTBGYES-UHFFFAOYSA-M |
| XLogP | -3.08 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|