C22H27ClN6O — CID 11270270
trimethyl-[4-morpholin-4-yl-6-(N-phenylanilino)-1,3,5-triazin-2-yl]azanium chloride (PubChem CID 11270270) has the molecular formula C22H27ClN6O and a molecular weight of 426.95 g/mol. Its IUPAC name is trimethyl-[4-morpholin-4-yl-6-(N-phenylanilino)-1,3,5-triazin-2-yl]azanium chloride.
| Compound Name | trimethyl-[4-morpholin-4-yl-6-(N-phenylanilino)-1,3,5-triazin-2-yl]azanium chloride |
|---|---|
| PubChem CID | 11270270 |
| Molecular Formula | C22H27ClN6O |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | trimethyl-[4-morpholin-4-yl-6-(N-phenylanilino)-1,3,5-triazin-2-yl]azanium chloride |
| SMILES | C[N+](C)(C)c1nc(N2CCOCC2)nc(N(c2ccccc2)c2ccccc2)n1.[Cl-] |
| InChI | InChI=1S/C22H27N6O.ClH/c1-28(2,3)22-24-20(26-14-16-29-17-15-26)23-21(25-22)27(18-10-6-4-7-11-18)19-12-8-5-9-13-19;/h4-13H,14-17H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | TVKCXWUDWYJKEF-UHFFFAOYSA-M |
| XLogP | 0.38 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|