C25H30N6O — CID 3927094
4-(azepan-1-yl)-6-morpholin-4-yl-N,N-diphenyl-1,3,5-triazin-2-amine (PubChem CID 3927094) has the molecular formula C25H30N6O and a molecular weight of 430.56 g/mol. Its IUPAC name is 4-(azepan-1-yl)-6-morpholin-4-yl-N,N-diphenyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(azepan-1-yl)-6-morpholin-4-yl-N,N-diphenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 3927094 |
| Molecular Formula | C25H30N6O |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 4-(azepan-1-yl)-6-morpholin-4-yl-N,N-diphenyl-1,3,5-triazin-2-amine |
| SMILES | c1ccc(N(c2ccccc2)c2nc(N3CCCCCC3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C25H30N6O/c1-2-10-16-29(15-9-1)23-26-24(30-17-19-32-20-18-30)28-25(27-23)31(21-11-5-3-6-12-21)22-13-7-4-8-14-22/h3-8,11-14H,1-2,9-10,15-20H2 |
| InChIKey | VWFMXOAOEWZQCH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 57.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |