C25H32N6O — CID 2172668
2-N-hexyl-6-morpholin-4-yl-4-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine (PubChem CID 2172668) has the molecular formula C25H32N6O and a molecular weight of 432.57 g/mol. Its IUPAC name is 2-N-hexyl-6-morpholin-4-yl-4-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-hexyl-6-morpholin-4-yl-4-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 2172668 |
| Molecular Formula | C25H32N6O |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 2-N-hexyl-6-morpholin-4-yl-4-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCNc1nc(N2CCOCC2)nc(N(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C25H32N6O/c1-2-3-4-11-16-26-23-27-24(30-17-19-32-20-18-30)29-25(28-23)31(21-12-7-5-8-13-21)22-14-9-6-10-15-22/h5-10,12-15H,2-4,11,16-20H2,1H3,(H,26,27,28,29) |
| InChIKey | JRERRAKMJYXIBH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|