C28H30N8O — CID 4289951
2-N-[[4-(dimethylamino)phenyl]methylideneamino]-6-morpholin-4-yl-4-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine (PubChem CID 4289951) has the molecular formula C28H30N8O and a molecular weight of 494.60 g/mol. Its IUPAC name is 2-N-[[4-(dimethylamino)phenyl]methylideneamino]-6-morpholin-4-yl-4-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[[4-(dimethylamino)phenyl]methylideneamino]-6-morpholin-4-yl-4-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 4289951 |
| Molecular Formula | C28H30N8O |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 2-N-[[4-(dimethylamino)phenyl]methylideneamino]-6-morpholin-4-yl-4-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1ccc(C=NNc2nc(N3CCOCC3)nc(N(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C28H30N8O/c1-34(2)23-15-13-22(14-16-23)21-29-33-26-30-27(35-17-19-37-20-18-35)32-28(31-26)36(24-9-5-3-6-10-24)25-11-7-4-8-12-25/h3-16,21H,17-20H2,1-2H3,(H,30,31,32,33) |
| InChIKey | SUGQQASMLZUNBQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|