C15H15N7O — CID 110178614
4-[(2E)-2-benzylidenehydrazinyl]-6-morpholin-4-yl-1,3,5-triazine-2-carbonitrile (PubChem CID 110178614) has the molecular formula C15H15N7O and a molecular weight of 309.33 g/mol. Its IUPAC name is 4-[(2E)-2-benzylidenehydrazinyl]-6-morpholin-4-yl-1,3,5-triazine-2-carbonitrile.
| Compound Name | 4-[(2E)-2-benzylidenehydrazinyl]-6-morpholin-4-yl-1,3,5-triazine-2-carbonitrile |
|---|---|
| PubChem CID | 110178614 |
| Molecular Formula | C15H15N7O |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 4-[(2E)-2-benzylidenehydrazinyl]-6-morpholin-4-yl-1,3,5-triazine-2-carbonitrile |
| SMILES | N#Cc1nc(N/N=C/c2ccccc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H15N7O/c16-10-13-18-14(21-17-11-12-4-2-1-3-5-12)20-15(19-13)22-6-8-23-9-7-22/h1-5,11H,6-9H2,(H,18,19,20,21)/b17-11+ |
| InChIKey | SEGAHUDWSTXFKE-GZTJUZNOSA-N |
| XLogP | 1.03 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|