C20H26N6O — CID 172962795
N-[(E)-benzylideneamino]-2-morpholin-4-yl-6-piperidin-1-ylpyrimidin-4-amine (PubChem CID 172962795) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-2-morpholin-4-yl-6-piperidin-1-ylpyrimidin-4-amine.
| Compound Name | N-[(E)-benzylideneamino]-2-morpholin-4-yl-6-piperidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 172962795 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | N-[(E)-benzylideneamino]-2-morpholin-4-yl-6-piperidin-1-ylpyrimidin-4-amine |
| SMILES | C(=N/Nc1cc(N2CCCCC2)nc(N2CCOCC2)n1)\c1ccccc1 |
| InChI | InChI=1S/C20H26N6O/c1-3-7-17(8-4-1)16-21-24-18-15-19(25-9-5-2-6-10-25)23-20(22-18)26-11-13-27-14-12-26/h1,3-4,7-8,15-16H,2,5-6,9-14H2,(H,22,23,24)/b21-16+ |
| InChIKey | UOXZNBWONRQYGJ-LTGZKZEYSA-N |
| XLogP | 2.75 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|