C20H26N6O2 — CID 6252798
N-[(Z)-(4-methylphenyl)methylideneamino]-2,6-dimorpholin-4-ylpyrimidin-4-amine (PubChem CID 6252798) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is N-[(Z)-(4-methylphenyl)methylideneamino]-2,6-dimorpholin-4-ylpyrimidin-4-amine.
| Compound Name | N-[(Z)-(4-methylphenyl)methylideneamino]-2,6-dimorpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 6252798 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | N-[(Z)-(4-methylphenyl)methylideneamino]-2,6-dimorpholin-4-ylpyrimidin-4-amine |
| SMILES | Cc1ccc(/C=N\Nc2cc(N3CCOCC3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C20H26N6O2/c1-16-2-4-17(5-3-16)15-21-24-18-14-19(25-6-10-27-11-7-25)23-20(22-18)26-8-12-28-13-9-26/h2-5,14-15H,6-13H2,1H3,(H,22,23,24)/b21-15- |
| InChIKey | GLWWPEHNKSUMGB-QNGOZBTKSA-N |
| XLogP | 1.90 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|