C25H37N7 — CID 3522387
N-[[4-(diethylamino)phenyl]methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine (PubChem CID 3522387) has the molecular formula C25H37N7 and a molecular weight of 435.62 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine.
| Compound Name | N-[[4-(diethylamino)phenyl]methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 3522387 |
| Molecular Formula | C25H37N7 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine |
| SMILES | CCN(CC)c1ccc(C=NNc2cc(N3CCCCC3)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C25H37N7/c1-3-30(4-2)22-13-11-21(12-14-22)20-26-29-23-19-24(31-15-7-5-8-16-31)28-25(27-23)32-17-9-6-10-18-32/h11-14,19-20H,3-10,15-18H2,1-2H3,(H,27,28,29) |
| InChIKey | QMLYSARPWSWWGJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|