C19H26N6O — CID 3091826
N-[[4-(diethylamino)phenyl]methylideneamino]-6-morpholin-4-ylpyrimidin-4-amine (PubChem CID 3091826) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methylideneamino]-6-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | N-[[4-(diethylamino)phenyl]methylideneamino]-6-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 3091826 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methylideneamino]-6-morpholin-4-ylpyrimidin-4-amine |
| SMILES | CCN(CC)c1ccc(C=NNc2cc(N3CCOCC3)ncn2)cc1 |
| InChI | InChI=1S/C19H26N6O/c1-3-24(4-2)17-7-5-16(6-8-17)14-22-23-18-13-19(21-15-20-18)25-9-11-26-12-10-25/h5-8,13-15H,3-4,9-12H2,1-2H3,(H,20,21,23) |
| InChIKey | RFYJJRPCWMXPJP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|