C27H32Cl2N4O — CID 42917264
3,4-dichloro-N-[(E)-[(3E)-3-[[4-(diethylamino)phenyl]methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]aniline (PubChem CID 42917264) has the molecular formula C27H32Cl2N4O and a molecular weight of 499.49 g/mol. Its IUPAC name is 3,4-dichloro-N-[(E)-[(3E)-3-[[4-(diethylamino)phenyl]methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]aniline.
| Compound Name | 3,4-dichloro-N-[(E)-[(3E)-3-[[4-(diethylamino)phenyl]methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 42917264 |
| Molecular Formula | C27H32Cl2N4O |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 3,4-dichloro-N-[(E)-[(3E)-3-[[4-(diethylamino)phenyl]methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]aniline |
| SMILES | CCN(CC)c1ccc(/C=C2\CCC(/C=N/Nc3ccc(Cl)c(Cl)c3)=C2N2CCOCC2)cc1 |
| InChI | InChI=1S/C27H32Cl2N4O/c1-3-32(4-2)24-10-5-20(6-11-24)17-21-7-8-22(27(21)33-13-15-34-16-14-33)19-30-31-23-9-12-25(28)26(29)18-23/h5-6,9-12,17-19,31H,3-4,7-8,13-16H2,1-2H3/b21-17+,30-19+ |
| InChIKey | WUXLQMNZUQIASH-AELAADBVSA-N |
| XLogP | 6.70 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hzone_enamin(30)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|