C27H33N5O — CID 92954270
N,N-diethyl-4-[(E)-[2-morpholin-4-yl-3-[(Z)-[(E)-pyridin-3-ylmethylidenehydrazinylidene]methyl]cyclopent-2-en-1-ylidene]methyl]aniline (PubChem CID 92954270) has the molecular formula C27H33N5O and a molecular weight of 443.60 g/mol. Its IUPAC name is N,N-diethyl-4-[(E)-[2-morpholin-4-yl-3-[(Z)-[(E)-pyridin-3-ylmethylidenehydrazinylidene]methyl]cyclopent-2-en-1-ylidene]methyl]aniline.
| Compound Name | N,N-diethyl-4-[(E)-[2-morpholin-4-yl-3-[(Z)-[(E)-pyridin-3-ylmethylidenehydrazinylidene]methyl]cyclopent-2-en-1-ylidene]methyl]aniline |
|---|---|
| PubChem CID | 92954270 |
| Molecular Formula | C27H33N5O |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | N,N-diethyl-4-[(E)-[2-morpholin-4-yl-3-[(Z)-[(E)-pyridin-3-ylmethylidenehydrazinylidene]methyl]cyclopent-2-en-1-ylidene]methyl]aniline |
| SMILES | CCN(CC)c1ccc(/C=C2\CCC(/C=N\N=C\c3cccnc3)=C2N2CCOCC2)cc1 |
| InChI | InChI=1S/C27H33N5O/c1-3-31(4-2)26-11-7-22(8-12-26)18-24-9-10-25(27(24)32-14-16-33-17-15-32)21-30-29-20-23-6-5-13-28-19-23/h5-8,11-13,18-21H,3-4,9-10,14-17H2,1-2H3/b24-18+,29-20+,30-21- |
| InChIKey | IFUPFELSZJZFLF-PJVHUAFJSA-N |
| XLogP | 4.80 |
| TPSA | 53.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|