C31H48N5O3P — CID 3406499
3-[[4-(diethylamino)phenyl]methylidene]-N-di(piperidin-1-yl)phosphoryl-2-morpholin-4-ylcyclopentene-1-carboxamide (PubChem CID 3406499) has the molecular formula C31H48N5O3P and a molecular weight of 569.73 g/mol. Its IUPAC name is 3-[[4-(diethylamino)phenyl]methylidene]-N-di(piperidin-1-yl)phosphoryl-2-morpholin-4-ylcyclopentene-1-carboxamide.
| Compound Name | 3-[[4-(diethylamino)phenyl]methylidene]-N-di(piperidin-1-yl)phosphoryl-2-morpholin-4-ylcyclopentene-1-carboxamide |
|---|---|
| PubChem CID | 3406499 |
| Molecular Formula | C31H48N5O3P |
| Molecular Weight | 569.73 g/mol |
| Exact Mass | 569.35 |
| IUPAC Name | 3-[[4-(diethylamino)phenyl]methylidene]-N-di(piperidin-1-yl)phosphoryl-2-morpholin-4-ylcyclopentene-1-carboxamide |
| SMILES | CCN(CC)c1ccc(C=C2CCC(C(=O)NP(=O)(N3CCCCC3)N3CCCCC3)=C2N2CCOCC2)cc1 |
| InChI | InChI=1S/C31H48N5O3P/c1-3-33(4-2)28-14-11-26(12-15-28)25-27-13-16-29(30(27)34-21-23-39-24-22-34)31(37)32-40(38,35-17-7-5-8-18-35)36-19-9-6-10-20-36/h11-12,14-15,25H,3-10,13,16-24H2,1-2H3,(H,32,37,38) |
| InChIKey | SCFFTSJYTRNQGF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.73 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|