C29H44N5O3P — CID 75408561
(3Z)-3-[[4-(diethylamino)phenyl]methylidene]-N-dipyrrolidin-1-ylphosphoryl-2-morpholin-4-ylcyclopentene-1-carboxamide (PubChem CID 75408561) has the molecular formula C29H44N5O3P and a molecular weight of 541.68 g/mol. Its IUPAC name is (3Z)-3-[[4-(diethylamino)phenyl]methylidene]-N-dipyrrolidin-1-ylphosphoryl-2-morpholin-4-ylcyclopentene-1-carboxamide.
| Compound Name | (3Z)-3-[[4-(diethylamino)phenyl]methylidene]-N-dipyrrolidin-1-ylphosphoryl-2-morpholin-4-ylcyclopentene-1-carboxamide |
|---|---|
| PubChem CID | 75408561 |
| Molecular Formula | C29H44N5O3P |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | (3Z)-3-[[4-(diethylamino)phenyl]methylidene]-N-dipyrrolidin-1-ylphosphoryl-2-morpholin-4-ylcyclopentene-1-carboxamide |
| SMILES | CCN(CC)c1ccc(/C=C2/CCC(C(=O)NP(=O)(N3CCCC3)N3CCCC3)=C2N2CCOCC2)cc1 |
| InChI | InChI=1S/C29H44N5O3P/c1-3-31(4-2)26-12-9-24(10-13-26)23-25-11-14-27(28(25)32-19-21-37-22-20-32)29(35)30-38(36,33-15-5-6-16-33)34-17-7-8-18-34/h9-10,12-13,23H,3-8,11,14-22H2,1-2H3,(H,30,35,36)/b25-23- |
| InChIKey | MAKWIKZTIRNIPI-BZZOAKBMSA-N |
| XLogP | 4.71 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|