C22H26N2O4 — CID 3458596
1-(3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl)-2-morpholin-4-ylethane-1,2-dione (PubChem CID 3458596) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-(3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl)-2-morpholin-4-ylethane-1,2-dione.
| Compound Name | 1-(3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl)-2-morpholin-4-ylethane-1,2-dione |
|---|---|
| PubChem CID | 3458596 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-(3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl)-2-morpholin-4-ylethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCOCC1)C1=C(N2CCOCC2)C(=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H26N2O4/c25-21(22(26)24-10-14-28-15-11-24)19-7-6-18(16-17-4-2-1-3-5-17)20(19)23-8-12-27-13-9-23/h1-5,16H,6-15H2 |
| InChIKey | NPMPIHGXVMLVHF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|