C30H32N2O3 — CID 2332901
(3Z)-1-[(3E)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]-3-(1,3,3-trimethylindol-2-ylidene)propane-1,2-dione (PubChem CID 2332901) has the molecular formula C30H32N2O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is (3Z)-1-[(3E)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]-3-(1,3,3-trimethylindol-2-ylidene)propane-1,2-dione.
| Compound Name | (3Z)-1-[(3E)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]-3-(1,3,3-trimethylindol-2-ylidene)propane-1,2-dione |
|---|---|
| PubChem CID | 2332901 |
| Molecular Formula | C30H32N2O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | (3Z)-1-[(3E)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]-3-(1,3,3-trimethylindol-2-ylidene)propane-1,2-dione |
| SMILES | CN1/C(=C\C(=O)C(=O)C2=C(N3CCOCC3)/C(=C/c3ccccc3)CC2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C30H32N2O3/c1-30(2)24-11-7-8-12-25(24)31(3)27(30)20-26(33)29(34)23-14-13-22(19-21-9-5-4-6-10-21)28(23)32-15-17-35-18-16-32/h4-12,19-20H,13-18H2,1-3H3/b22-19+,27-20- |
| InChIKey | ZZZUKLDLRLWYTQ-NTTDJHBSSA-N |
| XLogP | 4.90 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|