C35H42N3O+ — CID 59171319
4-[2,5-bis[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclopentylidene]morpholin-4-ium (PubChem CID 59171319) has the molecular formula C35H42N3O+ and a molecular weight of 520.74 g/mol. Its IUPAC name is 4-[2,5-bis[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclopentylidene]morpholin-4-ium.
| Compound Name | 4-[2,5-bis[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclopentylidene]morpholin-4-ium |
|---|---|
| PubChem CID | 59171319 |
| Molecular Formula | C35H42N3O+ |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | 4-[2,5-bis[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclopentylidene]morpholin-4-ium |
| SMILES | CN1C(=CC=C2CCC(=CC=C3N(C)c4ccccc4C3(C)C)C2=[N+]2CCOCC2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C35H42N3O/c1-34(2)27-11-7-9-13-29(27)36(5)31(34)19-17-25-15-16-26(33(25)38-21-23-39-24-22-38)18-20-32-35(3,4)28-12-8-10-14-30(28)37(32)6/h7-14,17-20H,15-16,21-24H2,1-6H3/q+1 |
| InChIKey | MFKFXCSSMXIVMS-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 18.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|