C37H49N4+ — CID 123492892
2-(dimethylamino)ethyl-methyl-[(2E,6E)-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-6-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexylidene]azanium (PubChem CID 123492892) has the molecular formula C37H49N4+ and a molecular weight of 549.83 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl-methyl-[(2E,6E)-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-6-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexylidene]azanium.
| Compound Name | 2-(dimethylamino)ethyl-methyl-[(2E,6E)-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-6-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexylidene]azanium |
|---|---|
| PubChem CID | 123492892 |
| Molecular Formula | C37H49N4+ |
| Molecular Weight | 549.83 g/mol |
| Exact Mass | 549.40 |
| IUPAC Name | 2-(dimethylamino)ethyl-methyl-[(2E,6E)-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-6-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexylidene]azanium |
| SMILES | CN(C)CC/[N+](C)=C1\C(=C\C=C2N(C)c3ccccc3C2(C)C)\CCC\C1=C/C=C1/N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C37H49N4/c1-36(2)29-17-10-12-19-31(29)40(8)33(36)23-21-27-15-14-16-28(35(27)39(7)26-25-38(5)6)22-24-34-37(3,4)30-18-11-13-20-32(30)41(34)9/h10-13,17-24H,14-16,25-26H2,1-9H3/q+1 |
| InChIKey | CNWHYUUKLBVFHR-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 12.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.83 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|