C45H48N3+ — CID 152774344
diphenyl-[(5E)-2-[2-(1,3,3,5-tetramethylindol-2-ylidene)ethylidene]-5-[(2E)-2-(1,3,3,5-tetramethylindol-2-ylidene)ethylidene]cyclopentylidene]azanium (PubChem CID 152774344) has the molecular formula C45H48N3+ and a molecular weight of 630.90 g/mol. Its IUPAC name is diphenyl-[(5E)-2-[2-(1,3,3,5-tetramethylindol-2-ylidene)ethylidene]-5-[(2E)-2-(1,3,3,5-tetramethylindol-2-ylidene)ethylidene]cyclopentylidene]azanium.
| Compound Name | diphenyl-[(5E)-2-[2-(1,3,3,5-tetramethylindol-2-ylidene)ethylidene]-5-[(2E)-2-(1,3,3,5-tetramethylindol-2-ylidene)ethylidene]cyclopentylidene]azanium |
|---|---|
| PubChem CID | 152774344 |
| Molecular Formula | C45H48N3+ |
| Molecular Weight | 630.90 g/mol |
| Exact Mass | 630.38 |
| IUPAC Name | diphenyl-[(5E)-2-[2-(1,3,3,5-tetramethylindol-2-ylidene)ethylidene]-5-[(2E)-2-(1,3,3,5-tetramethylindol-2-ylidene)ethylidene]cyclopentylidene]azanium |
| SMILES | Cc1ccc2c(c1)C(C)(C)C(=CC=C1CC/C(=C\C=C3\N(C)c4ccc(C)cc4C3(C)C)C1=[N+](c1ccccc1)c1ccccc1)N2C |
| InChI | InChI=1S/C45H48N3/c1-31-19-25-39-37(29-31)44(3,4)41(46(39)7)27-23-33-21-22-34(24-28-42-45(5,6)38-30-32(2)20-26-40(38)47(42)8)43(33)48(35-15-11-9-12-16-35)36-17-13-10-14-18-36/h9-20,23-30H,21-22H2,1-8H3/q+1 |
| InChIKey | NIVPLFUBQMJSIT-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.90 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|