C51H56N3O4+ — CID 58996005
[(2E,5E)-2,5-bis[(2E)-2-[1-(3-methoxy-3-oxopropyl)-3,3,5-trimethylindol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium (PubChem CID 58996005) has the molecular formula C51H56N3O4+ and a molecular weight of 775.03 g/mol. Its IUPAC name is [(2E,5E)-2,5-bis[(2E)-2-[1-(3-methoxy-3-oxopropyl)-3,3,5-trimethylindol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium.
| Compound Name | [(2E,5E)-2,5-bis[(2E)-2-[1-(3-methoxy-3-oxopropyl)-3,3,5-trimethylindol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium |
|---|---|
| PubChem CID | 58996005 |
| Molecular Formula | C51H56N3O4+ |
| Molecular Weight | 775.03 g/mol |
| Exact Mass | 774.43 |
| IUPAC Name | [(2E,5E)-2,5-bis[(2E)-2-[1-(3-methoxy-3-oxopropyl)-3,3,5-trimethylindol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium |
| SMILES | COC(=O)CCN1/C(=C/C=C2\CC/C(=C\C=C3\N(CCC(=O)OC)c4ccc(C)cc4C3(C)C)C2=[N+](c2ccccc2)c2ccccc2)C(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C51H56N3O4/c1-35-19-25-43-41(33-35)50(3,4)45(52(43)31-29-47(55)57-7)27-23-37-21-22-38(49(37)54(39-15-11-9-12-16-39)40-17-13-10-14-18-40)24-28-46-51(5,6)42-34-36(2)20-26-44(42)53(46)32-30-48(56)58-8/h9-20,23-28,33-34H,21-22,29-32H2,1-8H3/q+1 |
| InChIKey | TZAUSDFXUYKQDF-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 62.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.03 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|