C49H52N3O4+ — CID 123769946
[2,5-bis[2-[1-(2-acetyloxyethyl)-3,3-dimethylindol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium (PubChem CID 123769946) has the molecular formula C49H52N3O4+ and a molecular weight of 746.97 g/mol. Its IUPAC name is [2,5-bis[2-[1-(2-acetyloxyethyl)-3,3-dimethylindol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium.
| Compound Name | [2,5-bis[2-[1-(2-acetyloxyethyl)-3,3-dimethylindol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium |
|---|---|
| PubChem CID | 123769946 |
| Molecular Formula | C49H52N3O4+ |
| Molecular Weight | 746.97 g/mol |
| Exact Mass | 746.40 |
| IUPAC Name | [2,5-bis[2-[1-(2-acetyloxyethyl)-3,3-dimethylindol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium |
| SMILES | CC(=O)OCCN1C(=CC=C2CCC(=CC=C3N(CCOC(C)=O)c4ccccc4C3(C)C)C2=[N+](c2ccccc2)c2ccccc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C49H52N3O4/c1-35(53)55-33-31-50-43-23-15-13-21-41(43)48(3,4)45(50)29-27-37-25-26-38(47(37)52(39-17-9-7-10-18-39)40-19-11-8-12-20-40)28-30-46-49(5,6)42-22-14-16-24-44(42)51(46)32-34-56-36(2)54/h7-24,27-30H,25-26,31-34H2,1-6H3/q+1 |
| InChIKey | ZBECJVFPCCFSLZ-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 62.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.97 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|