C59H60N3+ — CID 76649467
[2,5-bis[2-[3,3,5-trimethyl-1-(2-phenylethyl)indol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium (PubChem CID 76649467) has the molecular formula C59H60N3+ and a molecular weight of 811.15 g/mol. Its IUPAC name is [2,5-bis[2-[3,3,5-trimethyl-1-(2-phenylethyl)indol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium.
| Compound Name | [2,5-bis[2-[3,3,5-trimethyl-1-(2-phenylethyl)indol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium |
|---|---|
| PubChem CID | 76649467 |
| Molecular Formula | C59H60N3+ |
| Molecular Weight | 811.15 g/mol |
| Exact Mass | 810.48 |
| IUPAC Name | [2,5-bis[2-[3,3,5-trimethyl-1-(2-phenylethyl)indol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium |
| SMILES | Cc1ccc2c(c1)C(C)(C)C(=CC=C1CCC(=CC=C3N(CCc4ccccc4)c4ccc(C)cc4C3(C)C)C1=[N+](c1ccccc1)c1ccccc1)N2CCc1ccccc1 |
| InChI | InChI=1S/C59H60N3/c1-43-27-33-53-51(41-43)58(3,4)55(60(53)39-37-45-19-11-7-12-20-45)35-31-47-29-30-48(57(47)62(49-23-15-9-16-24-49)50-25-17-10-18-26-50)32-36-56-59(5,6)52-42-44(2)28-34-54(52)61(56)40-38-46-21-13-8-14-22-46/h7-28,31-36,41-42H,29-30,37-40H2,1-6H3/q+1 |
| InChIKey | WXFLIAMULORATH-UHFFFAOYSA-N |
| XLogP | 14.07 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.15 |
| LogP ≤ 5 | 14.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|