C53H60N3O4+ — CID 58830864
[(2E,5E)-2,5-bis[(2E)-2-[1-(4-methoxy-4-oxobutyl)-3,3,5-trimethylindol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium (PubChem CID 58830864) has the molecular formula C53H60N3O4+ and a molecular weight of 803.08 g/mol. Its IUPAC name is [(2E,5E)-2,5-bis[(2E)-2-[1-(4-methoxy-4-oxobutyl)-3,3,5-trimethylindol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium.
| Compound Name | [(2E,5E)-2,5-bis[(2E)-2-[1-(4-methoxy-4-oxobutyl)-3,3,5-trimethylindol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium |
|---|---|
| PubChem CID | 58830864 |
| Molecular Formula | C53H60N3O4+ |
| Molecular Weight | 803.08 g/mol |
| Exact Mass | 802.46 |
| IUPAC Name | [(2E,5E)-2,5-bis[(2E)-2-[1-(4-methoxy-4-oxobutyl)-3,3,5-trimethylindol-2-ylidene]ethylidene]cyclopentylidene]-diphenylazanium |
| SMILES | COC(=O)CCCN1/C(=C/C=C2\CC/C(=C\C=C3\N(CCCC(=O)OC)c4ccc(C)cc4C3(C)C)C2=[N+](c2ccccc2)c2ccccc2)C(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C53H60N3O4/c1-37-23-29-45-43(35-37)52(3,4)47(54(45)33-15-21-49(57)59-7)31-27-39-25-26-40(51(39)56(41-17-11-9-12-18-41)42-19-13-10-14-20-42)28-32-48-53(5,6)44-36-38(2)24-30-46(44)55(48)34-16-22-50(58)60-8/h9-14,17-20,23-24,27-32,35-36H,15-16,21-22,25-26,33-34H2,1-8H3/q+1 |
| InChIKey | MMKYQICZPNCGIU-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 62.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.08 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|