C47H52N3+ — CID 123737301
[2,5-bis[2-(3,3-dimethyl-1-propylindol-2-ylidene)ethylidene]cyclopentylidene]-diphenylazanium (PubChem CID 123737301) has the molecular formula C47H52N3+ and a molecular weight of 658.95 g/mol. Its IUPAC name is [2,5-bis[2-(3,3-dimethyl-1-propylindol-2-ylidene)ethylidene]cyclopentylidene]-diphenylazanium.
| Compound Name | [2,5-bis[2-(3,3-dimethyl-1-propylindol-2-ylidene)ethylidene]cyclopentylidene]-diphenylazanium |
|---|---|
| PubChem CID | 123737301 |
| Molecular Formula | C47H52N3+ |
| Molecular Weight | 658.95 g/mol |
| Exact Mass | 658.42 |
| IUPAC Name | [2,5-bis[2-(3,3-dimethyl-1-propylindol-2-ylidene)ethylidene]cyclopentylidene]-diphenylazanium |
| SMILES | CCCN1C(=CC=C2CCC(=CC=C3N(CCC)c4ccccc4C3(C)C)C2=[N+](c2ccccc2)c2ccccc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C47H52N3/c1-7-33-48-41-25-17-15-23-39(41)46(3,4)43(48)31-29-35-27-28-36(45(35)50(37-19-11-9-12-20-37)38-21-13-10-14-22-38)30-32-44-47(5,6)40-24-16-18-26-42(40)49(44)34-8-2/h9-26,29-32H,7-8,27-28,33-34H2,1-6H3/q+1 |
| InChIKey | UKMSNVJMSSSNJK-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.95 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|