C43H46N5+ — CID 58965919
[(2E,5E)-2,5-bis[(2E)-2-(1-ethyl-3,3-dimethylpyrrolo[2,3-b]pyridin-2-ylidene)ethylidene]cyclopentylidene]-diphenylazanium (PubChem CID 58965919) has the molecular formula C43H46N5+ and a molecular weight of 632.88 g/mol. Its IUPAC name is [(2E,5E)-2,5-bis[(2E)-2-(1-ethyl-3,3-dimethylpyrrolo[2,3-b]pyridin-2-ylidene)ethylidene]cyclopentylidene]-diphenylazanium.
| Compound Name | [(2E,5E)-2,5-bis[(2E)-2-(1-ethyl-3,3-dimethylpyrrolo[2,3-b]pyridin-2-ylidene)ethylidene]cyclopentylidene]-diphenylazanium |
|---|---|
| PubChem CID | 58965919 |
| Molecular Formula | C43H46N5+ |
| Molecular Weight | 632.88 g/mol |
| Exact Mass | 632.37 |
| IUPAC Name | [(2E,5E)-2,5-bis[(2E)-2-(1-ethyl-3,3-dimethylpyrrolo[2,3-b]pyridin-2-ylidene)ethylidene]cyclopentylidene]-diphenylazanium |
| SMILES | CCN1/C(=C/C=C2\CC/C(=C\C=C3\N(CC)c4ncccc4C3(C)C)C2=[N+](c2ccccc2)c2ccccc2)C(C)(C)c2cccnc21 |
| InChI | InChI=1S/C43H46N5/c1-7-46-37(42(3,4)35-21-15-29-44-40(35)46)27-25-31-23-24-32(26-28-38-43(5,6)36-22-16-30-45-41(36)47(38)8-2)39(31)48(33-17-11-9-12-18-33)34-19-13-10-14-20-34/h9-22,25-30H,7-8,23-24H2,1-6H3/q+1 |
| InChIKey | UGOGHXXMCBRAMN-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 35.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.88 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|