C53H52N3+ — CID 123848681
[(2E)-2,5-bis[(2E)-2-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)ethylidene]cyclopentylidene]-diphenylazanium (PubChem CID 123848681) has the molecular formula C53H52N3+ and a molecular weight of 731.02 g/mol. Its IUPAC name is [(2E)-2,5-bis[(2E)-2-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)ethylidene]cyclopentylidene]-diphenylazanium.
| Compound Name | [(2E)-2,5-bis[(2E)-2-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)ethylidene]cyclopentylidene]-diphenylazanium |
|---|---|
| PubChem CID | 123848681 |
| Molecular Formula | C53H52N3+ |
| Molecular Weight | 731.02 g/mol |
| Exact Mass | 730.42 |
| IUPAC Name | [(2E)-2,5-bis[(2E)-2-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)ethylidene]cyclopentylidene]-diphenylazanium |
| SMILES | CCN1/C(=C/C=C2CC/C(=C\C=C3\N(CC)c4ccc5ccccc5c4C3(C)C)C2=[N+](c2ccccc2)c2ccccc2)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C53H52N3/c1-7-54-45-33-29-37-19-15-17-25-43(37)49(45)52(3,4)47(54)35-31-39-27-28-40(51(39)56(41-21-11-9-12-22-41)42-23-13-10-14-24-42)32-36-48-53(5,6)50-44-26-18-16-20-38(44)30-34-46(50)55(48)8-2/h9-26,29-36H,7-8,27-28H2,1-6H3/q+1 |
| InChIKey | KUYNAWDAYSJYOQ-UHFFFAOYSA-N |
| XLogP | 13.32 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.02 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|