C41H42N2O — CID 177409719
(2Z,5E)-2,5-bis[(2E)-2-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)ethylidene]cyclopentan-1-one (PubChem CID 177409719) has the molecular formula C41H42N2O and a molecular weight of 578.80 g/mol. Its IUPAC name is (2Z,5E)-2,5-bis[(2E)-2-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)ethylidene]cyclopentan-1-one.
| Compound Name | (2Z,5E)-2,5-bis[(2E)-2-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)ethylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 177409719 |
| Molecular Formula | C41H42N2O |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.33 |
| IUPAC Name | (2Z,5E)-2,5-bis[(2E)-2-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)ethylidene]cyclopentan-1-one |
| SMILES | CCN1/C(=C/C=C2/CC/C(=C\C=C3\N(CC)c4ccc5ccccc5c4C3(C)C)C2=O)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C41H42N2O/c1-7-42-33-23-19-27-13-9-11-15-31(27)37(33)40(3,4)35(42)25-21-29-17-18-30(39(29)44)22-26-36-41(5,6)38-32-16-12-10-14-28(32)20-24-34(38)43(36)8-2/h9-16,19-26H,7-8,17-18H2,1-6H3/b29-21-,30-22+,35-25+,36-26+ |
| InChIKey | UDEXQVFVORRMCD-RSTHNOKISA-N |
| XLogP | 9.91 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|