C51H56N2O4 — CID 137028744
5-[(2E)-2,5-bis[(2E)-2-(3-butyl-1,1-dimethylbenzo[e]indol-2-ylidene)ethylidene]cyclopentylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 137028744) has the molecular formula C51H56N2O4 and a molecular weight of 761.02 g/mol. Its IUPAC name is 5-[(2E)-2,5-bis[(2E)-2-(3-butyl-1,1-dimethylbenzo[e]indol-2-ylidene)ethylidene]cyclopentylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2E)-2,5-bis[(2E)-2-(3-butyl-1,1-dimethylbenzo[e]indol-2-ylidene)ethylidene]cyclopentylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 137028744 |
| Molecular Formula | C51H56N2O4 |
| Molecular Weight | 761.02 g/mol |
| Exact Mass | 760.42 |
| IUPAC Name | 5-[(2E)-2,5-bis[(2E)-2-(3-butyl-1,1-dimethylbenzo[e]indol-2-ylidene)ethylidene]cyclopentylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCCCN1/C(=C/C=C2CC/C(=C\C=C3\N(CCCC)c4ccc5ccccc5c4C3(C)C)C2=C2C(=O)OC(C)(C)OC2=O)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C51H56N2O4/c1-9-11-31-52-39-27-23-33-17-13-15-19-37(33)45(39)49(3,4)41(52)29-25-35-21-22-36(43(35)44-47(54)56-51(7,8)57-48(44)55)26-30-42-50(5,6)46-38-20-16-14-18-34(38)24-28-40(46)53(42)32-12-10-2/h13-20,23-30H,9-12,21-22,31-32H2,1-8H3/b35-25+,36-26?,41-29+,42-30+ |
| InChIKey | SRVRYAPAMLZJDN-OKYNXZBRSA-N |
| XLogP | 12.04 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.02 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|