C47H48N4O3 — CID 90161914
5-[(2E,5E)-2,5-bis[(2E)-2-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)ethylidene]cyclopentylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 90161914) has the molecular formula C47H48N4O3 and a molecular weight of 716.93 g/mol. Its IUPAC name is 5-[(2E,5E)-2,5-bis[(2E)-2-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)ethylidene]cyclopentylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2E,5E)-2,5-bis[(2E)-2-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)ethylidene]cyclopentylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 90161914 |
| Molecular Formula | C47H48N4O3 |
| Molecular Weight | 716.93 g/mol |
| Exact Mass | 716.37 |
| IUPAC Name | 5-[(2E,5E)-2,5-bis[(2E)-2-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)ethylidene]cyclopentylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1/C(=C/C=C2\CC/C(=C\C=C3\N(CC)c4ccc5ccccc5c4C3(C)C)C2=C2C(=O)N(C)C(=O)N(C)C2=O)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C47H48N4O3/c1-9-50-35-25-21-29-15-11-13-17-33(29)41(35)46(3,4)37(50)27-23-31-19-20-32(39(31)40-43(52)48(7)45(54)49(8)44(40)53)24-28-38-47(5,6)42-34-18-14-12-16-30(34)22-26-36(42)51(38)10-2/h11-18,21-28H,9-10,19-20H2,1-8H3/b31-23+,32-24+,37-27+,38-28+ |
| InChIKey | KWZJTQWAZITPTR-AMBDOIOXSA-N |
| XLogP | 9.69 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.93 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|