C47H60N3O7S3+ — CID 143373418
[(2E,5E)-2,5-bis[(2E)-2-[3,3-dimethyl-1-(4-sulfobutyl)indol-2-ylidene]ethylidene]cyclopentylidene]-tert-butylsulfinyl-phenylazanium (PubChem CID 143373418) has the molecular formula C47H60N3O7S3+ and a molecular weight of 875.21 g/mol. Its IUPAC name is [(2E,5E)-2,5-bis[(2E)-2-[3,3-dimethyl-1-(4-sulfobutyl)indol-2-ylidene]ethylidene]cyclopentylidene]-tert-butylsulfinyl-phenylazanium.
| Compound Name | [(2E,5E)-2,5-bis[(2E)-2-[3,3-dimethyl-1-(4-sulfobutyl)indol-2-ylidene]ethylidene]cyclopentylidene]-tert-butylsulfinyl-phenylazanium |
|---|---|
| PubChem CID | 143373418 |
| Molecular Formula | C47H60N3O7S3+ |
| Molecular Weight | 875.21 g/mol |
| Exact Mass | 874.36 |
| IUPAC Name | [(2E,5E)-2,5-bis[(2E)-2-[3,3-dimethyl-1-(4-sulfobutyl)indol-2-ylidene]ethylidene]cyclopentylidene]-tert-butylsulfinyl-phenylazanium |
| SMILES | CC1(C)/C(=C\C=C2/CC/C(=C\C=C3\N(CCCCS(=O)(=O)O)c4ccccc4C3(C)C)C2=[N+](c2ccccc2)S(=O)C(C)(C)C)N(CCCCS(=O)(=O)O)c2ccccc21 |
| InChI | InChI=1S/C47H59N3O7S3/c1-45(2,3)58(51)50(37-19-9-8-10-20-37)44-35(27-29-42-46(4,5)38-21-11-13-23-40(38)48(42)31-15-17-33-59(52,53)54)25-26-36(44)28-30-43-47(6,7)39-22-12-14-24-41(39)49(43)32-16-18-34-60(55,56)57/h8-14,19-24,27-30H,15-18,25-26,31-34H2,1-7H3,(H-,52,53,54,55,56,57)/p+1 |
| InChIKey | KGTODPNZQYGMRH-UHFFFAOYSA-O |
| XLogP | 9.58 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.21 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|