C41H52N3O10S2+ — CID 59783084
[(2E,5E)-2,5-bis[(2Z)-2-[5-carboxy-3,3-dimethyl-1-(3-sulfopropyl)indol-2-ylidene]ethylidene]cyclopentylidene]-diethylazanium (PubChem CID 59783084) has the molecular formula C41H52N3O10S2+ and a molecular weight of 811.01 g/mol. Its IUPAC name is [(2E,5E)-2,5-bis[(2Z)-2-[5-carboxy-3,3-dimethyl-1-(3-sulfopropyl)indol-2-ylidene]ethylidene]cyclopentylidene]-diethylazanium.
| Compound Name | [(2E,5E)-2,5-bis[(2Z)-2-[5-carboxy-3,3-dimethyl-1-(3-sulfopropyl)indol-2-ylidene]ethylidene]cyclopentylidene]-diethylazanium |
|---|---|
| PubChem CID | 59783084 |
| Molecular Formula | C41H52N3O10S2+ |
| Molecular Weight | 811.01 g/mol |
| Exact Mass | 810.31 |
| IUPAC Name | [(2E,5E)-2,5-bis[(2Z)-2-[5-carboxy-3,3-dimethyl-1-(3-sulfopropyl)indol-2-ylidene]ethylidene]cyclopentylidene]-diethylazanium |
| SMILES | CC[N+](CC)=C1/C(=C/C=C2\N(CCCS(=O)(=O)O)c3ccc(C(=O)O)cc3C2(C)C)CC/C1=C\C=C1/N(CCCS(=O)(=O)O)c2ccc(C(=O)O)cc2C1(C)C |
| InChI | InChI=1S/C41H51N3O10S2/c1-7-42(8-2)37-27(15-19-35-40(3,4)31-25-29(38(45)46)13-17-33(31)43(35)21-9-23-55(49,50)51)11-12-28(37)16-20-36-41(5,6)32-26-30(39(47)48)14-18-34(32)44(36)22-10-24-56(52,53)54/h13-20,25-26H,7-12,21-24H2,1-6H3,(H3-,45,46,47,48,49,50,51,52,53,54)/p+1 |
| InChIKey | VKCMLLDURMGGEQ-UHFFFAOYSA-O |
| XLogP | 6.44 |
| TPSA | 192.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.01 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|