C22H27N2OPS — CID 2331348
morpholin-4-yl-phenyl-sulfanylidene-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]-lambda5-phosphane (PubChem CID 2331348) has the molecular formula C22H27N2OPS and a molecular weight of 398.51 g/mol. Its IUPAC name is morpholin-4-yl-phenyl-sulfanylidene-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]-lambda5-phosphane.
| Compound Name | morpholin-4-yl-phenyl-sulfanylidene-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]-lambda5-phosphane |
|---|---|
| PubChem CID | 2331348 |
| Molecular Formula | C22H27N2OPS |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | morpholin-4-yl-phenyl-sulfanylidene-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]-lambda5-phosphane |
| SMILES | CN1/C(=C\P(=S)(c2ccccc2)N2CCOCC2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C22H27N2OPS/c1-22(2)19-11-7-8-12-20(19)23(3)21(22)17-26(27,18-9-5-4-6-10-18)24-13-15-25-16-14-24/h4-12,17H,13-16H2,1-3H3/b21-17- |
| InChIKey | HFACUBYTCGPLOZ-FXBPSFAMSA-N |
| XLogP | 4.31 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|