About N-ethyl-N-[ethyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine
N-ethyl-N-[ethyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine (PubChem CID 11913497) has the molecular formula C18H29N2PS
and a molecular weight of 336.49 g/mol. Its IUPAC name is N-ethyl-N-[ethyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine.
Molecular Properties
| Compound Name | N-ethyl-N-[ethyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine |
| PubChem CID | 11913497 |
| Molecular Formula | C18H29N2PS |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-ethyl-N-[ethyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine |
| SMILES | CCN(CC)[P@](=S)(/C=C1/N(C)c2ccccc2C1(C)C)CC |
| InChI | InChI=1S/C18H29N2PS/c1-7-20(8-2)21(22,9-3)14-17-18(4,5)15-12-10-11-13-16(15)19(17)6/h10-14H,7-9H2,1-6H3/b17-14+/t21-/m1/s1 |
| InChIKey | AQLWASPJJLZYSQ-PVGBUVFQSA-N |
| XLogP | 5.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-[ethyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[ethyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine?
The IUPAC name of N-ethyl-N-[ethyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine (CID 11913497) is N-ethyl-N-[ethyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine.
What is the SMILES notation for N-ethyl-N-[ethyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine?
The canonical SMILES for N-ethyl-N-[ethyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine is CCN(CC)[P@](=S)(/C=C1/N(C)c2ccccc2C1(C)C)CC.
What is the InChIKey of N-ethyl-N-[ethyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine?
The InChIKey is AQLWASPJJLZYSQ-PVGBUVFQSA-N. The full InChI is InChI=1S/C18H29N2PS/c1-7-20(8-2)21(22,9-3)14-17-18(4,5)15-12-10-11-13-16(15)19(17)6/h10-14H,7-9H2,1-6H3/b17-14+/t21-/m1/s1.
What are the key properties of N-ethyl-N-[ethyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine?
N-ethyl-N-[ethyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine has a molecular weight of 336.49 g/mol, XLogP of 5.01, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[ethyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine is sourced from PubChem (CID 11913497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).