C18H29N2PS — CID 2327517
N-ethyl-N-[ethyl-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine (PubChem CID 2327517) has the molecular formula C18H29N2PS and a molecular weight of 336.49 g/mol. Its IUPAC name is N-ethyl-N-[ethyl-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine.
| Compound Name | N-ethyl-N-[ethyl-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine |
|---|---|
| PubChem CID | 2327517 |
| Molecular Formula | C18H29N2PS |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-ethyl-N-[ethyl-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]ethanamine |
| SMILES | CCN(CC)P(=S)(/C=C1\N(C)c2ccccc2C1(C)C)CC |
| InChI | InChI=1S/C18H29N2PS/c1-7-20(8-2)21(22,9-3)14-17-18(4,5)15-12-10-11-13-16(15)19(17)6/h10-14H,7-9H2,1-6H3/b17-14- |
| InChIKey | AQLWASPJJLZYSQ-VKAVYKQESA-N |
| XLogP | 5.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|