C32H31N2O2PS — CID 11865027
N-(4-methoxyphenyl)-1-[4-[phenyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]oxyphenyl]methanimine (PubChem CID 11865027) has the molecular formula C32H31N2O2PS and a molecular weight of 538.65 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1-[4-[phenyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]oxyphenyl]methanimine.
| Compound Name | N-(4-methoxyphenyl)-1-[4-[phenyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]oxyphenyl]methanimine |
|---|---|
| PubChem CID | 11865027 |
| Molecular Formula | C32H31N2O2PS |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | N-(4-methoxyphenyl)-1-[4-[phenyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]oxyphenyl]methanimine |
| SMILES | COc1ccc(/N=C/c2ccc(O[P@](=S)(/C=C3/N(C)c4ccccc4C3(C)C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C32H31N2O2PS/c1-32(2)29-12-8-9-13-30(29)34(3)31(32)23-37(38,28-10-6-5-7-11-28)36-27-18-14-24(15-19-27)22-33-25-16-20-26(35-4)21-17-25/h5-23H,1-4H3/b31-23+,33-22+/t37-/m0/s1 |
| InChIKey | OAIDRGLYUJGANY-FVNQKZSFSA-N |
| XLogP | 7.81 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|