C35H34N5OPS2 — CID 42917187
N-[(E)-[4-[phenyl-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]oxyphenyl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 42917187) has the molecular formula C35H34N5OPS2 and a molecular weight of 635.80 g/mol. Its IUPAC name is N-[(E)-[4-[phenyl-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]oxyphenyl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(E)-[4-[phenyl-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]oxyphenyl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 42917187 |
| Molecular Formula | C35H34N5OPS2 |
| Molecular Weight | 635.80 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | N-[(E)-[4-[phenyl-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]phosphinothioyl]oxyphenyl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | CN1/C(=C\P(=S)(Oc2ccc(/C=N/Nc3ncnc4sc5c(c34)CCCC5)cc2)c2ccccc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C35H34N5OPS2/c1-35(2)28-14-8-9-15-29(28)40(3)31(35)22-42(43,26-11-5-4-6-12-26)41-25-19-17-24(18-20-25)21-38-39-33-32-27-13-7-10-16-30(27)44-34(32)37-23-36-33/h4-6,8-9,11-12,14-15,17-23H,7,10,13,16H2,1-3H3,(H,36,37,39)/b31-22-,38-21+ |
| InChIKey | QYGZHYWXGFOONG-BPQJBFKVSA-N |
| XLogP | 8.38 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.80 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|