C17H16FN5S — CID 171905503
N-[(E)-(4-fluorophenyl)methylideneamino]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 171905503) has the molecular formula C17H16FN5S and a molecular weight of 341.42 g/mol. Its IUPAC name is N-[(E)-(4-fluorophenyl)methylideneamino]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | N-[(E)-(4-fluorophenyl)methylideneamino]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 171905503 |
| Molecular Formula | C17H16FN5S |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-[(E)-(4-fluorophenyl)methylideneamino]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | CN1CCc2c(sc3ncnc(N/N=C/c4ccc(F)cc4)c23)C1 |
| InChI | InChI=1S/C17H16FN5S/c1-23-7-6-13-14(9-23)24-17-15(13)16(19-10-20-17)22-21-8-11-2-4-12(18)5-3-11/h2-5,8,10H,6-7,9H2,1H3,(H,19,20,22)/b21-8+ |
| InChIKey | MSDZYAHLLXGLPK-ODCIPOBUSA-N |
| XLogP | 3.26 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|