C16H14ClFN4S — CID 155553572
N-(4-chloro-2-fluorophenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 155553572) has the molecular formula C16H14ClFN4S and a molecular weight of 348.83 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | N-(4-chloro-2-fluorophenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 155553572 |
| Molecular Formula | C16H14ClFN4S |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | CN1CCc2c(sc3ncnc(Nc4ccc(Cl)cc4F)c23)C1 |
| InChI | InChI=1S/C16H14ClFN4S/c1-22-5-4-10-13(7-22)23-16-14(10)15(19-8-20-16)21-12-3-2-9(17)6-11(12)18/h2-3,6,8H,4-5,7H2,1H3,(H,19,20,21) |
| InChIKey | OYRNXOFIKGIUTR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |