C21H21F2N5OS — CID 66877967
1-[3-(2,4-difluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(dimethylamino)but-2-en-1-one (PubChem CID 66877967) has the molecular formula C21H21F2N5OS and a molecular weight of 429.50 g/mol. Its IUPAC name is 1-[3-(2,4-difluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(dimethylamino)but-2-en-1-one.
| Compound Name | 1-[3-(2,4-difluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(dimethylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 66877967 |
| Molecular Formula | C21H21F2N5OS |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 1-[3-(2,4-difluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(dimethylamino)but-2-en-1-one |
| SMILES | CN(C)CC=CC(=O)N1CCc2c(sc3ncnc(Nc4ccc(F)cc4F)c23)C1 |
| InChI | InChI=1S/C21H21F2N5OS/c1-27(2)8-3-4-18(29)28-9-7-14-17(11-28)30-21-19(14)20(24-12-25-21)26-16-6-5-13(22)10-15(16)23/h3-6,10,12H,7-9,11H2,1-2H3,(H,24,25,26) |
| InChIKey | HESTTXMZBKRKAY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|