C29H33N7O2S — CID 167459297
(E)-4-(dimethylamino)-1-[3-[4-[[6-(dimethylamino)-3-pyridinyl]oxy]-3-methylanilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one (PubChem CID 167459297) has the molecular formula C29H33N7O2S and a molecular weight of 543.70 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-[3-[4-[[6-(dimethylamino)-3-pyridinyl]oxy]-3-methylanilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one.
| Compound Name | (E)-4-(dimethylamino)-1-[3-[4-[[6-(dimethylamino)-3-pyridinyl]oxy]-3-methylanilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 167459297 |
| Molecular Formula | C29H33N7O2S |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | (E)-4-(dimethylamino)-1-[3-[4-[[6-(dimethylamino)-3-pyridinyl]oxy]-3-methylanilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
| SMILES | Cc1cc(Nc2ncnc3sc4c(c23)CCN(C(=O)/C=C/CN(C)C)C4)ccc1Oc1ccc(N(C)C)nc1 |
| InChI | InChI=1S/C29H33N7O2S/c1-19-15-20(8-10-23(19)38-21-9-11-25(30-16-21)35(4)5)33-28-27-22-12-14-36(26(37)7-6-13-34(2)3)17-24(22)39-29(27)32-18-31-28/h6-11,15-16,18H,12-14,17H2,1-5H3,(H,31,32,33)/b7-6+ |
| InChIKey | JMDFNCHGVQPLGD-VOTSOKGWSA-N |
| XLogP | 5.00 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|