C33H36F2N6O3S — CID 167459354
(E)-4-[[4-(difluoromethoxy)cyclohexyl]amino]-1-[3-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one (PubChem CID 167459354) has the molecular formula C33H36F2N6O3S and a molecular weight of 634.75 g/mol. Its IUPAC name is (E)-4-[[4-(difluoromethoxy)cyclohexyl]amino]-1-[3-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one.
| Compound Name | (E)-4-[[4-(difluoromethoxy)cyclohexyl]amino]-1-[3-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 167459354 |
| Molecular Formula | C33H36F2N6O3S |
| Molecular Weight | 634.75 g/mol |
| Exact Mass | 634.25 |
| IUPAC Name | (E)-4-[[4-(difluoromethoxy)cyclohexyl]amino]-1-[3-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
| SMILES | Cc1ccc(Oc2ccc(Nc3ncnc4sc5c(c34)CCN(C(=O)/C=C/CNC3CCC(OC(F)F)CC3)C5)cc2C)cn1 |
| InChI | InChI=1S/C33H36F2N6O3S/c1-20-16-23(8-12-27(20)43-25-9-5-21(2)37-17-25)40-31-30-26-13-15-41(18-28(26)45-32(30)39-19-38-31)29(42)4-3-14-36-22-6-10-24(11-7-22)44-33(34)35/h3-5,8-9,12,16-17,19,22,24,33,36H,6-7,10-11,13-15,18H2,1-2H3,(H,38,39,40)/b4-3+ |
| InChIKey | RLIOOXXNETVJOC-ONEGZZNKSA-N |
| XLogP | 6.82 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.75 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|