C32H34N6O2S — CID 172518023
(E)-4-(7-azabicyclo[2.2.1]heptan-7-yl)-1-[3-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one (PubChem CID 172518023) has the molecular formula C32H34N6O2S and a molecular weight of 566.73 g/mol. Its IUPAC name is (E)-4-(7-azabicyclo[2.2.1]heptan-7-yl)-1-[3-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one.
| Compound Name | (E)-4-(7-azabicyclo[2.2.1]heptan-7-yl)-1-[3-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 172518023 |
| Molecular Formula | C32H34N6O2S |
| Molecular Weight | 566.73 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | (E)-4-(7-azabicyclo[2.2.1]heptan-7-yl)-1-[3-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
| SMILES | Cc1ccc(Oc2ccc(Nc3ncnc4sc5c(c34)CCN(C(=O)/C=C/CN3C4CCC3CC4)C5)cc2C)cn1 |
| InChI | InChI=1S/C32H34N6O2S/c1-20-16-22(6-12-27(20)40-25-11-5-21(2)33-17-25)36-31-30-26-13-15-37(18-28(26)41-32(30)35-19-34-31)29(39)4-3-14-38-23-7-8-24(38)10-9-23/h3-6,11-12,16-17,19,23-24H,7-10,13-15,18H2,1-2H3,(H,34,35,36)/b4-3+ |
| InChIKey | HQBJJGUOJZJJDS-ONEGZZNKSA-N |
| XLogP | 6.31 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.73 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|