C24H27N5OS — CID 70806936
(E)-1-[3-(3-methylanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-pyrrolidin-1-ylbut-2-en-1-one (PubChem CID 70806936) has the molecular formula C24H27N5OS and a molecular weight of 433.58 g/mol. Its IUPAC name is (E)-1-[3-(3-methylanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-pyrrolidin-1-ylbut-2-en-1-one.
| Compound Name | (E)-1-[3-(3-methylanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-pyrrolidin-1-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 70806936 |
| Molecular Formula | C24H27N5OS |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (E)-1-[3-(3-methylanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-pyrrolidin-1-ylbut-2-en-1-one |
| SMILES | Cc1cccc(Nc2ncnc3sc4c(c23)CCN(C(=O)/C=C/CN2CCCC2)C4)c1 |
| InChI | InChI=1S/C24H27N5OS/c1-17-6-4-7-18(14-17)27-23-22-19-9-13-29(15-20(19)31-24(22)26-16-25-23)21(30)8-5-12-28-10-2-3-11-28/h4-8,14,16H,2-3,9-13,15H2,1H3,(H,25,26,27)/b8-5+ |
| InChIKey | KNPNNMDOIAAZTB-VMPITWQZSA-N |
| XLogP | 4.28 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|