C32H33N7OS — CID 66877764
1-[3-[(1-benzylindazol-5-yl)amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-piperidin-1-ylbut-2-en-1-one (PubChem CID 66877764) has the molecular formula C32H33N7OS and a molecular weight of 563.73 g/mol. Its IUPAC name is 1-[3-[(1-benzylindazol-5-yl)amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-piperidin-1-ylbut-2-en-1-one.
| Compound Name | 1-[3-[(1-benzylindazol-5-yl)amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-piperidin-1-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 66877764 |
| Molecular Formula | C32H33N7OS |
| Molecular Weight | 563.73 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | 1-[3-[(1-benzylindazol-5-yl)amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-piperidin-1-ylbut-2-en-1-one |
| SMILES | O=C(C=CCN1CCCCC1)N1CCc2c(sc3ncnc(Nc4ccc5c(cnn5Cc5ccccc5)c4)c23)C1 |
| InChI | InChI=1S/C32H33N7OS/c40-29(10-7-16-37-14-5-2-6-15-37)38-17-13-26-28(21-38)41-32-30(26)31(33-22-34-32)36-25-11-12-27-24(18-25)19-35-39(27)20-23-8-3-1-4-9-23/h1,3-4,7-12,18-19,22H,2,5-6,13-17,20-21H2,(H,33,34,36) |
| InChIKey | ZZMOYCIJVMJKNM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.73 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|